EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12O |
| Net Charge | 0 |
| Average Mass | 88.150 |
| Monoisotopic Mass | 88.08882 |
| SMILES | CCC[C@H](C)O |
| InChI | InChI=1S/C5H12O/c1-3-4-5(2)6/h5-6H,3-4H2,1-2H3/t5-/m0/s1 |
| InChIKey | JYVLIDXNZAXMDK-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Role: | polar solvent A solvent that is composed of polar molecules. Polar solvents can dissolve ionic compounds or ionisable covalent compounds. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. polar solvent A solvent that is composed of polar molecules. Polar solvents can dissolve ionic compounds or ionisable covalent compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-pentan-2-ol (CHEBI:747903) is a pentan-2-ol (CHEBI:77518) |
| UniProt Name | Source |
|---|---|
| (2S)-pentan-2-ol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-19082 | MetaCyc |
| Citations |
|---|