EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15N |
| Net Charge | 0 |
| Average Mass | 209.292 |
| Monoisotopic Mass | 209.12045 |
| SMILES | [H][C@@]12CNC[C@]1(c1ccc3ccccc3c1)C2 |
| InChI | InChI=1S/C15H15N/c1-2-4-12-7-13(6-5-11(12)3-1)15-8-14(15)9-16-10-15/h1-7,14,16H,8-10H2/t14-,15+/m1/s1 |
| InChIKey | HKHCSWPSUSWGLI-CABCVRRESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | inhibitor A substance that diminishes the rate of a chemical reaction. |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| centanafadine (CHEBI:747899) has role antidepressant (CHEBI:35469) |
| centanafadine (CHEBI:747899) has role inhibitor (CHEBI:35222) |
| centanafadine (CHEBI:747899) is a naphthalenes (CHEBI:25477) |
| centanafadine (CHEBI:747899) is a secondary amino compound (CHEBI:50995) |
| INNs | Source |
|---|---|
| centanafadina | WHO MedNet |
| centanafadine | WHO MedNet |
| Synonyms | Source |
|---|---|
| DOV 216,419 | ChEMBL |
| DOV-216419 | ChEMBL |
| DOV 216,419 free base | ChEMBL |
| EB-1020 | ChEMBL |
| EB-1020 free base | ChEMBL |