EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H7ClF2INO2 |
| Net Charge | 0 |
| Average Mass | 409.557 |
| Monoisotopic Mass | 408.91781 |
| SMILES | O=C(O)c1ccc(F)c(F)c1Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C13H7ClF2INO2/c14-8-5-6(17)1-4-10(8)18-12-7(13(19)20)2-3-9(15)11(12)16/h1-5,18H,(H,19,20) |
| InChIKey | XCNBGWKQXRQKSA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. antiviral agent A substance that destroys or inhibits replication of viruses. EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zapnometinib (CHEBI:747895) has role anticoronaviral agent (CHEBI:149553) |
| zapnometinib (CHEBI:747895) has role antiviral agent (CHEBI:22587) |
| zapnometinib (CHEBI:747895) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| INN | Source |
|---|---|
| zapnometinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Atr 002 | ChEMBL |
| ATR-002 | ChEMBL |
| ATR002 | ChEMBL |
| PD-0184264 | ChEMBL |
| Citations |
|---|