EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17N5O7S3 |
| Net Charge | 0 |
| Average Mass | 523.574 |
| Monoisotopic Mass | 523.02901 |
| SMILES | [H][C@]12SCC(CSC(=O)c3ccco3)=C(C(=O)O)N1C(=O)[C@H]2NC(=O)/C(=N\OC)c1csc(N)n1 |
| InChI | InChI=1S/C19H17N5O7S3/c1-30-23-11(9-7-34-19(20)21-9)14(25)22-12-15(26)24-13(17(27)28)8(5-32-16(12)24)6-33-18(29)10-3-2-4-31-10/h2-4,7,12,16H,5-6H2,1H3,(H2,20,21)(H,22,25)(H,27,28)/b23-11-/t12-,16-/m1/s1 |
| InChIKey | ZBHXIWJRIFEVQY-IHMPYVIRSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceftiofur (CHEBI:747894) is a β-lactam antibiotic (CHEBI:27933) |
| Synonyms | Source |
|---|---|
| Ceftiofur | ChEMBL |
| Ceftiofur crystalline free acid | ChEMBL |
| naxcel | KEGG DRUG |
| Citations |
|---|