EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10N2 |
| Net Charge | 0 |
| Average Mass | 194.237 |
| Monoisotopic Mass | 194.08440 |
| SMILES | Nc1c2ccccc2nc2ccccc12 |
| InChI | InChI=1S/C13H10N2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H,(H2,14,15) |
| InChIKey | XJGFWWJLMVZSIG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| Applications: | MALDI matrix material A compound used to form the matrix for MALDI (matrix-assisted laser desorption/ionization) mass spectrometry. MALDI matrix materials are crystalline compounds with a fairly low molecular weight, so as to allow facile vaporization, have strong absorption at UV or IR wavelengths (to rapidly and efficiently absorb laser irradiation), generally contain polar groups (enabling them to be used in aqueous solutions) and are frequently acidic (so assisting ionisation of the compound being studied, which is contained within the matrix material). acid-base indicator An acid or base which exhibits a colour change on neutralization by the basic or acidic titrant at or near the equivalence point of a titration. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-aminoacridine (CHEBI:74789) has role acid-base indicator (CHEBI:50407) |
| 9-aminoacridine (CHEBI:74789) has role antiinfective agent (CHEBI:35441) |
| 9-aminoacridine (CHEBI:74789) has role antiseptic drug (CHEBI:48218) |
| 9-aminoacridine (CHEBI:74789) has role fluorescent dye (CHEBI:51121) |
| 9-aminoacridine (CHEBI:74789) has role MALDI matrix material (CHEBI:64345) |
| 9-aminoacridine (CHEBI:74789) has role mutagen (CHEBI:25435) |
| 9-aminoacridine (CHEBI:74789) is a aminoacridines (CHEBI:51803) |
| 9-aminoacridine (CHEBI:74789) is a primary amino compound (CHEBI:50994) |
| 9-aminoacridine (CHEBI:74789) is conjugate base of 9-aminoacridine(1+) (CHEBI:74835) |
| Incoming Relation(s) |
| 9-aminoacridine(1+) (CHEBI:74835) is conjugate acid of 9-aminoacridine (CHEBI:74789) |
| IUPAC Name |
|---|
| acridin-9-amine |
| INNs | Source |
|---|---|
| aminoacridina | WHO MedNet |
| aminoacridine | WHO MedNet |
| aminoacridine | WHO MedNet |
| aminoacridinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 10-amino-5-azaanthracene | NIST Chemistry WebBook |
| 5-aminoacridine | ChEBI |
| 9AA | NIST Chemistry WebBook |
| 9-acridinamine | ChemIDplus |
| aminacrin | NIST Chemistry WebBook |
| aminacrine | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 160 | DrugCentral |
| 9-Aminoacridine | Wikipedia |
| LSM-15516 | LINCS |
| Citations |
|---|