EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6F5O2 |
| Net Charge | -1 |
| Average Mass | 205.102 |
| Monoisotopic Mass | 205.02934 |
| SMILES | O=C([O-])CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H7F5O2/c7-5(8,6(9,10)11)3-1-2-4(12)13/h1-3H2,(H,12,13)/p-1 |
| InChIKey | VQNQZVLVFCPHTP-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5,5,6,6,6-pentafluorohexanoate (CHEBI:747880) is a monocarboxylic acid (CHEBI:25384) |
| 5,5,6,6,6-pentafluorohexanoate (CHEBI:747880) is a organohalogen compound (CHEBI:17792) |
| UniProt Name | Source |
|---|---|
| 5,5,6,6,6-pentafluorohexanoate | UniProt |