EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:747875 - HF13141-H5
| Formula | C24H21N3O4 |
| Net Charge | 0 |
| Average Mass | 415.449 |
| Monoisotopic Mass | 415.15321 |
| SMILES | O=C(Nc1ccc(OCc2ccccc2)cc1)OCCn1ncc2ccccc2c1=O |
| InChI | InChI=1S/C24H21N3O4/c28-23-22-9-5-4-8-19(22)16-25-27(23)14-15-30-24(29)26-20-10-12-21(13-11-20)31-17-18-6-2-1-3-7-18/h1-13,16H,14-15,17H2,(H,26,29) |
| InChIKey | NOTMNJWNPBTHMP-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| HF13141-H5 (CHEBI:747875) is a aromatic ether (CHEBI:35618) |
| HF13141-H5 (CHEBI:747875) is a benzenes (CHEBI:22712) |
| HF13141-H5 (CHEBI:747875) is a carbamate ester (CHEBI:23003) |
| HF13141-H5 (CHEBI:747875) is a phthalazines (CHEBI:38768) |
| IUPAC Name |
|---|
| 2-(1-oxophthalazin-2(1H)-yl)ethyl [4-(benzyloxy)phenyl]carbamate |
| Citations |
|---|