EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13F2O5P |
| Net Charge | 0 |
| Average Mass | 342.234 |
| Monoisotopic Mass | 342.04687 |
| SMILES | O=P(O)(O)OCOc1ccc(/C=C/c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C15H13F2O5P/c16-13-7-12(8-14(17)9-13)2-1-11-3-5-15(6-4-11)21-10-22-23(18,19)20/h1-9H,10H2,(H2,18,19,20)/b2-1+ |
| InChIKey | RIVVKGWQXPJDQG-OWOJBTEDSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| {4-[(E)-2-(3,5-difluorophenyl)ethenyl]phenoxy}methyl dihydrogen phosphate (CHEBI:747874) has role antineoplastic agent (CHEBI:35610) |
| {4-[(E)-2-(3,5-difluorophenyl)ethenyl]phenoxy}methyl dihydrogen phosphate (CHEBI:747874) has role prodrug (CHEBI:50266) |
| {4-[(E)-2-(3,5-difluorophenyl)ethenyl]phenoxy}methyl dihydrogen phosphate (CHEBI:747874) is a aromatic ether (CHEBI:35618) |
| {4-[(E)-2-(3,5-difluorophenyl)ethenyl]phenoxy}methyl dihydrogen phosphate (CHEBI:747874) is a difluorobenzene (CHEBI:38582) |
| {4-[(E)-2-(3,5-difluorophenyl)ethenyl]phenoxy}methyl dihydrogen phosphate (CHEBI:747874) is a organic phosphate (CHEBI:25703) |
| {4-[(E)-2-(3,5-difluorophenyl)ethenyl]phenoxy}methyl dihydrogen phosphate (CHEBI:747874) is a stilbenoid (CHEBI:26776) |
| IUPAC Name |
|---|
| {4-[(E)-2-(3,5-difluorophenyl)ethenyl]phenoxy}methyl dihydrogen phosphate |