EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H41N9O4 |
| Net Charge | 0 |
| Average Mass | 615.739 |
| Monoisotopic Mass | 615.32815 |
| SMILES | CN(C)C1CCN(C(=O)c2ccc(NC(=O)Nc3ccc(-c4nc(N5CCOCC5)nc(N5CCOCC5)n4)cc3)cc2)CC1 |
| InChI | InChI=1S/C32H41N9O4/c1-38(2)27-11-13-39(14-12-27)29(42)24-5-9-26(10-6-24)34-32(43)33-25-7-3-23(4-8-25)28-35-30(40-15-19-44-20-16-40)37-31(36-28)41-17-21-45-22-18-41/h3-10,27H,11-22H2,1-2H3,(H2,33,34,43) |
| InChIKey | DWZAEMINVBZMHQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gedatolisib (CHEBI:747853) has role antineoplastic agent (CHEBI:35610) |
| Gedatolisib (CHEBI:747853) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| gedatolisib | WHO MedNet |
| Synonyms | Source |
|---|---|
| PF-05212384 | CAS |
| PKI-587 | CAS |
| Registry Numbers | Sources |
|---|---|
| CAS:1197160-78-3 | CAS |
| Citations |
|---|