EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H17F2NO4 |
| Net Charge | 0 |
| Average Mass | 421.399 |
| Monoisotopic Mass | 421.11256 |
| SMILES | COc1ccc(-c2cc(=O)oc3c4c(ccc23)OCN(c2ccc(F)cc2F)C4)cc1 |
| InChI | InChI=1S/C24H17F2NO4/c1-29-16-5-2-14(3-6-16)18-11-23(28)31-24-17(18)7-9-22-19(24)12-27(13-30-22)21-8-4-15(25)10-20(21)26/h2-11H,12-13H2,1H3 |
| InChIKey | JXSCUIVTIWDPBB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NPD2560 (CHEBI:747849) has role antifungal agent (CHEBI:35718) |
| NPD2560 (CHEBI:747849) is a difluorobenzene (CHEBI:38582) |
| NPD2560 (CHEBI:747849) is a monomethoxybenzene (CHEBI:25235) |
| NPD2560 (CHEBI:747849) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| 9-(2,4-difluorophenyl)-4-(4-methoxyphenyl)-9,10-dihydro-2H,8H-chromeno[8,7-e][1,3]oxazin-2-one |
| Synonyms | Source |
|---|---|
| 9-(2,4-difluorophenyl)-4-(4-methoxyphenyl)-2H,8H,9H,10H-chromeno[8,7-e][1,3]oxazin-2-one | ChEBI |
| 9-(2,4-difluorophenyl)-4-(4-methoxyphenyl)-9,10-dihydro-2H,8H-pyrano[2,3-f][1,3]benzoxazin-2-one | IUPAC |
| NPD 2560 | ChEBI |
| NPD-2560 | ChEBI |
| Citations |
|---|