EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:747844 - obeldesivir
| Formula | C16H19N5O5 |
| Net Charge | 0 |
| Average Mass | 361.358 |
| Monoisotopic Mass | 361.13862 |
| SMILES | CC(C)C(=O)OC[C@H]1O[C@@](C#N)(c2ccc3c(N)ncnn23)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H19N5O5/c1-8(2)15(24)25-5-10-12(22)13(23)16(6-17,26-10)11-4-3-9-14(18)19-7-20-21(9)11/h3-4,7-8,10,12-13,22-23H,5H2,1-2H3,(H2,18,19,20)/t10-,12-,13-,16+/m1/s1 |
| InChIKey | YIHPGVCWGSURHO-VSBTWAGUSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 2.7.7.6 (RNA polymerase) inhibitor An EC 2.7.7.* (nucleotidyltransferase) inhibitor that interferes with the action of RNA polymerase (EC 2.7.7.6). |
| Application: | prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| obeldesivir (CHEBI:747844) has role EC 2.7.7.6 (RNA polymerase) inhibitor (CHEBI:37416) |
| obeldesivir (CHEBI:747844) has role prodrug (CHEBI:50266) |
| obeldesivir (CHEBI:747844) is a nitrile (CHEBI:18379) |
| obeldesivir (CHEBI:747844) is a pyrrolotriazine (CHEBI:88341) |
| Synonyms | Source |
|---|---|
| ATV006 | Wikipedia |
| GS-5245 | Wikipedia |