EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H25N3O2S |
| Net Charge | 0 |
| Average Mass | 335.473 |
| Monoisotopic Mass | 335.16675 |
| SMILES | CNS(=O)(=O)CCc1ccc2ncc(C3CCN(C)CC3)c2c1 |
| InChI | InChI=1S/C17H25N3O2S/c1-18-23(21,22)10-7-13-3-4-17-15(11-13)16(12-19-17)14-5-8-20(2)9-6-14/h3-4,11-12,14,18-19H,5-10H2,1-2H3 |
| InChIKey | AMKVXSZCKVJAGH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| Applications: | vasoconstrictor agent Drug used to cause constriction of the blood vessels. serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naratriptan (CHEBI:7478) has role serotonergic agonist (CHEBI:35941) |
| naratriptan (CHEBI:7478) has role vasoconstrictor agent (CHEBI:50514) |
| naratriptan (CHEBI:7478) is a heteroarylpiperidine (CHEBI:48585) |
| naratriptan (CHEBI:7478) is a indoles (CHEBI:24828) |
| naratriptan (CHEBI:7478) is a organic molecular entity (CHEBI:50860) |
| naratriptan (CHEBI:7478) is a sulfonamide (CHEBI:35358) |
| naratriptan (CHEBI:7478) is a tryptamines (CHEBI:27162) |
| Incoming Relation(s) |
| Naratriptan hydrochloride (CHEBI:7479) has part naratriptan (CHEBI:7478) |
| IUPAC Name |
|---|
| N-methyl-2-[3-(1-methylpiperidin-4-yl)-1H-indol-5-yl]ethanesulfonamide |
| INNs | Source |
|---|---|
| naratriptan | ChemIDplus |
| naratriptan | WHO MedNet |
| naratriptán | WHO MedNet |
| naratriptanum | WHO MedNet |
| Synonyms | Source |
|---|---|
| N-methyl-2-[3-(1-methyl-4-piperidyl)-1H-indol-5-yl]-ethanesulfonamide | IUPHAR |
| N-methyl-2-(3-(1-methylpiperiden-4-yl)indole-5-yl)ethanesulfonamide | ChemIDplus |
| naratriptan | IUPHAR |
| Manual Xrefs | Databases |
|---|---|
| 1884 | DrugCentral |
| C07792 | KEGG COMPOUND |
| D08255 | KEGG DRUG |
| DB00952 | DrugBank |
| Naratriptan | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7656719 | Beilstein |
| CAS:121679-13-8 | KEGG COMPOUND |
| CAS:121679-13-8 | ChemIDplus |
| Citations |
|---|