EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24O4S |
| Net Charge | 0 |
| Average Mass | 384.497 |
| Monoisotopic Mass | 384.13953 |
| SMILES | CSc1ccc(C(=O)/C=C/c2cc(C)c(OC(C)(C)C(=O)O)c(C)c2)cc1 |
| InChI | InChI=1S/C22H24O4S/c1-14-12-16(13-15(2)20(14)26-22(3,4)21(24)25)6-11-19(23)17-7-9-18(27-5)10-8-17/h6-13H,1-5H3,(H,24,25)/b11-6+ |
| InChIKey | AFLFKFHDSCQHOL-IZZDOVSWSA-N |
| Roles Classification |
|---|
| Biological Roles: | agonist Substance which binds to cell receptors normally responding to naturally occurring substances and which produces a response of its own. PPAR modulator Any compound which acts on the peroxisome proliferator-activated receptor. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elafibranor (CHEBI:747793) has role agonist (CHEBI:48705) |
| elafibranor (CHEBI:747793) has role hypoglycemic agent (CHEBI:35526) |
| elafibranor (CHEBI:747793) has role PPAR modulator (CHEBI:70781) |
| Synonyms | Source |
|---|---|
| Elafibranor | ChEMBL |
| GFT-505 | ChEMBL |
| GFT505 | ChEMBL |
| Brand Name | Source |
|---|---|
| Iqirvo | Wikipedia |
| Citations |
|---|