EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H17ClF3N9O2 |
| Net Charge | 0 |
| Average Mass | 531.886 |
| Monoisotopic Mass | 531.11458 |
| SMILES | Cn1cnc(Cn2c(=O)n/c(=N\c3cc4cn(C)nc4cc3Cl)n(Cc3cc(F)c(F)cc3F)c2=O)n1 |
| InChI | InChI=1S/C22H17ClF3N9O2/c1-32-7-12-4-18(13(23)5-17(12)30-32)28-20-29-21(36)35(9-19-27-10-33(2)31-19)22(37)34(20)8-11-3-15(25)16(26)6-14(11)24/h3-7,10H,8-9H2,1-2H3,(H,28,29,36) |
| InChIKey | QMPBBNUOBOFBFS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ensitrelvir (CHEBI:747786) has role anticoronaviral agent (CHEBI:149553) |
| ensitrelvir (CHEBI:747786) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| Brand Name | Source |
|---|---|
| Xocova | Wikipedia |