EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:747785 - coproporphyrin III tetramethyl ester
| Formula | C40H46N4O8 |
| Net Charge | 0 |
| Average Mass | 710.828 |
| Monoisotopic Mass | 710.33156 |
| SMILES | COC(=O)CCC1=C(C)c2cc3nc(cc4nc(cc5nc(cc1n2)c(C)c5CCC(=O)OC)C(CCC(=O)OC)=C4C)c(C)c3CCC(=O)OC |
| InChI | InChI=1S/C40H46N4O8/c1-21-25(9-13-37(45)49-5)33-18-31-23(3)26(10-14-38(46)50-6)34(43-31)19-32-24(4)28(12-16-40(48)52-8)36(44-32)20-35-27(11-15-39(47)51-7)22(2)30(42-35)17-29(21)41-33/h17-20,41,44H,9-16H2,1-8H3/b29-17-,30-17-,31-18-,32-19-,33-18-,34-19-,35-20-,36-20- |
| InChIKey | LBHYIBKOOKXTGC-LHPWBCDESA-N |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coproporphyrin III tetramethyl ester (CHEBI:747785) is a coproporphyrin (CHEBI:23388) |
| UniProt Name | Source |
|---|---|
| coproporphyrin III tetramethyl ester | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-28558 | MetaCyc |
| Citations |
|---|