EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H15ClN2O4 |
| Net Charge | 0 |
| Average Mass | 370.792 |
| Monoisotopic Mass | 370.07203 |
| SMILES | O=C(N[C@H](Cc1cc(=O)nc2ccccc12)C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H15ClN2O4/c20-13-7-5-11(6-8-13)18(24)22-16(19(25)26)9-12-10-17(23)21-15-4-2-1-3-14(12)15/h1-8,10,16H,9H2,(H,21,23)(H,22,24)(H,25,26)/t16-/m1/s1 |
| InChIKey | ALLWOAVDORUJLA-MRXNPFEDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-rebamipide (CHEBI:747740) is a N-(4-chlorobenzoyl)-3-(2-oxo-1,2-dihydroquinolin-4-yl)alanine (CHEBI:93814) |
| (R)-rebamipide (CHEBI:747740) is enantiomer of (S)-rebamipide (CHEBI:747741) |
| Incoming Relation(s) |
| rebamipide (CHEBI:32090) has part (R)-rebamipide (CHEBI:747740) |
| (S)-rebamipide (CHEBI:747741) is enantiomer of (R)-rebamipide (CHEBI:747740) |
| IUPAC Name |
|---|
| N-(4-chlorobenzoyl)-3-(2-oxo-1,2-dihydroquinolin-4-yl)-D-alanine |
| Synonyms | Source |
|---|---|
| (2R)-2-(4-chlorobenzamido)-3-(2-oxo-1,2-dihydroquinolin-4-yl)propanoic acid | IUPAC |
| (2R)-2-[(4-chlorobenzoyl)amino]-3-(2-oxo-1H-quinolin-4-yl)propanoic acid | PubChem Compound |
| (R)-2-(4-chlorobenzamido)-3-(2-oxo-1,2-dihydroquinolin-4-yl)propanoic acid | ChEBI |
| (R)-(+)-rebamipide | ChEBI |
| R-rebamipide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:111911-90-1 | PubChem Compound |