EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:747698 - a (2E)-N-acyl-2-dehydrotryptophan(1-)
| Formula | C12H8N2O3R |
| Net Charge | -1 |
| Average Mass (excl. R groups) | 228.207 |
| Monoisotopic Mass (excl. R groups) | 228.05404 |
| SMILES | *C(=O)N/C(=C/c1cnc2ccccc12)C(=O)[O-] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| a (2E)-N-acyl-2-dehydrotryptophan(1-) (CHEBI:747698) is a N-acyl-amino acid (CHEBI:51569) |
| UniProt Name | Source |
|---|---|
| a (2E)-N-acyl-2-dehydrotryptophan | UniProt |
| Manual Xrefs | Databases |
|---|---|
| N-Acyl-2-Dehydrotryptophans | MetaCyc |
| Citations |
|---|