EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O5 |
| Net Charge | 0 |
| Average Mass | 184.147 |
| Monoisotopic Mass | 184.03717 |
| SMILES | COC(=O)c1ccc(C(=O)OC)o1 |
| InChI | InChI=1S/C8H8O5/c1-11-7(9)5-3-4-6(13-5)8(10)12-2/h3-4H,1-2H3 |
| InChIKey | UWQOPFRNDNVUOA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | polymerisation monomer Any compound used as a monomer for a polymerisation process. The term is generally used in relation to industrial polymerisation processes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethyl furandicarboxylate (CHEBI:747694) has role polymerisation monomer (CHEBI:74236) |
| dimethyl furandicarboxylate (CHEBI:747694) is a furans (CHEBI:24129) |
| Synonym | Source |
|---|---|
| 2,5-dimethyl furan-2,5-dicarboxylate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:4282-32-0 | PubChem Compound |