EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8N2O2 |
| Net Charge | 0 |
| Average Mass | 140.142 |
| Monoisotopic Mass | 140.05858 |
| SMILES | Cc1cn(C)c(=O)nc1=O |
| InChI | InChI=1S/C6H8N2O2/c1-4-3-8(2)6(10)7-5(4)9/h3H,1-2H3,(H,7,9,10) |
| InChIKey | GKMIDMKPBOUSBQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,5-dimethyluracil (CHEBI:74765) has functional parent uracil (CHEBI:17568) |
| 1,5-dimethyluracil (CHEBI:74765) has role metabolite (CHEBI:25212) |
| 1,5-dimethyluracil (CHEBI:74765) is a methylthymine (CHEBI:134101) |
| IUPAC Name |
|---|
| 1,5-dimethylpyrimidine-2,4(1H,3H)-dione |
| Synonym | Source |
|---|---|
| 1-methylthymine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:127143 | Reaxys |
| CAS:4160-72-9 | ChemIDplus |
| Citations |
|---|