EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19N7O2 |
| Net Charge | 0 |
| Average Mass | 365.397 |
| Monoisotopic Mass | 365.16002 |
| SMILES | COc1cccc(OCCCN)c1-c1cc(Nc2cnc(C#N)cn2)nn1 |
| InChI | InChI=1S/C18H19N7O2/c1-26-14-4-2-5-15(27-7-3-6-19)18(14)13-8-16(25-24-13)23-17-11-21-12(9-20)10-22-17/h2,4-5,8,10-11H,3,6-7,19H2,1H3,(H2,22,23,24,25) |
| InChIKey | DOTGPNHGTYJDEP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Prexasertib (CHEBI:747627) has role antineoplastic agent (CHEBI:35610) |
| Prexasertib (CHEBI:747627) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| prexasertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| LY-2606368 | ChEMBL |
| LY2606368 | CAS |
| Registry Numbers | Sources |
|---|---|
| CAS:1234015-52-1 | CAS |
| Citations |
|---|