EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20N4O2 |
| Net Charge | 0 |
| Average Mass | 324.384 |
| Monoisotopic Mass | 324.15863 |
| SMILES | Cc1cc2c(C(N)=O)c(N)n(-c3c(C)ccc(O)c3C)c2nc1C |
| InChI | InChI=1S/C18H20N4O2/c1-8-5-6-13(23)10(3)15(8)22-16(19)14(17(20)24)12-7-9(2)11(4)21-18(12)22/h5-7,23H,19H2,1-4H3,(H2,20,24) |
| InChIKey | ARBRHWRTXPWZGN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| RP-6306 (CHEBI:747624) has role antineoplastic agent (CHEBI:35610) |
| RP-6306 (CHEBI:747624) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| lunresertib | CAS |
| lunresertib | ChEMBL |
| Rp 6306 | ChEMBL |
| RP-6306 | ChEMBL |
| RP6306 | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:2719793-90-3 | CAS |
| Citations |
|---|