EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N2O5 |
| Net Charge | 0 |
| Average Mass | 244.247 |
| Monoisotopic Mass | 244.10592 |
| SMILES | O=C(O)CC[C@H](NC(=O)[C@@H]1CCCN1)C(=O)O |
| InChI | InChI=1S/C10H16N2O5/c13-8(14)4-3-7(10(16)17)12-9(15)6-2-1-5-11-6/h6-7,11H,1-5H2,(H,12,15)(H,13,14)(H,16,17)/t6-,7-/m0/s1 |
| InChIKey | QLROSWPKSBORFJ-BQBZGAKWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pro-Glu (CHEBI:74762) has role metabolite (CHEBI:25212) |
| Pro-Glu (CHEBI:74762) is a dipeptide (CHEBI:46761) |
| Synonyms | Source |
|---|---|
| L-Pro-L-Glu | ChEBI |
| prolylglutamic acid | ChEBI |
| PE | ChEBI |
| N-L-Prolyl-L-glutamic acid | ChemIDplus |
| Prolyl-Glutamate | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029016 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27399 | Reaxys |
| CAS:67644-00-2 | ChemIDplus |