EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11N3 |
| Net Charge | 0 |
| Average Mass | 125.175 |
| Monoisotopic Mass | 125.09530 |
| SMILES | Cc1ncc(CCN)n1 |
| InChI | InChI=1S/C6H11N3/c1-5-8-4-6(9-5)2-3-7/h4H,2-3,7H2,1H3,(H,8,9) |
| InChIKey | XDKYTXBAVJELDQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | histamine agonist A drug that binds to and activates histamine receptors. Although they have been suggested for a variety of clinical applications, histamine agonists have so far been more widely used in research than therapeutically. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | histamine agonist A drug that binds to and activates histamine receptors. Although they have been suggested for a variety of clinical applications, histamine agonists have so far been more widely used in research than therapeutically. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylhistamine (CHEBI:74761) has functional parent histamine (CHEBI:18295) |
| 2-methylhistamine (CHEBI:74761) has role histamine agonist (CHEBI:35678) |
| 2-methylhistamine (CHEBI:74761) has role metabolite (CHEBI:25212) |
| 2-methylhistamine (CHEBI:74761) is a aralkylamino compound (CHEBI:64365) |
| 2-methylhistamine (CHEBI:74761) is a imidazoles (CHEBI:24780) |
| IUPAC Name |
|---|
| 2-(2-methyl-1H-imidazol-5-yl)ethanamine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:907356 | Reaxys |
| CAS:34392-54-6 | ChemIDplus |
| CAS:34392-54-6 | KEGG COMPOUND |
| Citations |
|---|