EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:74761 - 2-methylhistamine
| Formula | C6H11N3 |
| Net Charge | 0 |
| Average Mass | 125.175 |
| Monoisotopic Mass | 125.09530 |
| SMILES | Cc1ncc(CCN)n1 |
| InChI | InChI=1S/C6H11N3/c1-5-8-4-6(9-5)2-3-7/h4H,2-3,7H2,1H3,(H,8,9) |
| InChIKey | XDKYTXBAVJELDQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. histamine agonist A drug that binds to and activates histamine receptors. Although they have been suggested for a variety of clinical applications, histamine agonists have so far been more widely used in research than therapeutically. |
| Application: | histamine agonist A drug that binds to and activates histamine receptors. Although they have been suggested for a variety of clinical applications, histamine agonists have so far been more widely used in research than therapeutically. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylhistamine (CHEBI:74761) has functional parent histamine (CHEBI:18295) |
| 2-methylhistamine (CHEBI:74761) has role histamine agonist (CHEBI:35678) |
| 2-methylhistamine (CHEBI:74761) has role metabolite (CHEBI:25212) |
| 2-methylhistamine (CHEBI:74761) is a aralkylamino compound (CHEBI:64365) |
| 2-methylhistamine (CHEBI:74761) is a imidazoles (CHEBI:24780) |
| IUPAC Name |
|---|
| 2-(2-methyl-1H-imidazol-5-yl)ethanamine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:907356 | Reaxys |
| CAS:34392-54-6 | ChemIDplus |
| CAS:34392-54-6 | KEGG COMPOUND |
| Citations |
|---|