EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22N4O3 |
| Net Charge | 0 |
| Average Mass | 390.443 |
| Monoisotopic Mass | 390.16919 |
| SMILES | COc1ncc(C)c(-c2ccc3c(c2)nc(=O)c2cnn([C@H]4CCOC4)c23)c1C |
| InChI | InChI=1S/C22H22N4O3/c1-12-9-23-22(28-3)13(2)19(12)14-4-5-16-18(8-14)25-21(27)17-10-24-26(20(16)17)15-6-7-29-11-15/h4-5,8-10,15H,6-7,11H2,1-3H3,(H,25,27)/t15-/m0/s1 |
| InChIKey | CKJDCNZBABIEBZ-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| irsenontrine (CHEBI:747609) has role antiparkinson drug (CHEBI:48407) |
| irsenontrine (CHEBI:747609) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| irsenontrine | WHO MedNet |
| Synonyms | Source |
|---|---|
| E-2027 | ChEMBL |
| E2027 | DrugBank |
| ER-592221-00 | ChEMBL |
| Citations |
|---|