EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O7 |
| Net Charge | 0 |
| Average Mass | 374.389 |
| Monoisotopic Mass | 374.13655 |
| SMILES | COc1cc(C[C@H]2CO[C@H](c3ccc(O)c(OC)c3)[C@H]2C(=O)O)ccc1O |
| InChI | InChI=1S/C20H22O7/c1-25-16-8-11(3-5-14(16)21)7-13-10-27-19(18(13)20(23)24)12-4-6-15(22)17(9-12)26-2/h3-6,8-9,13,18-19,21-22H,7,10H2,1-2H3,(H,23,24)/t13-,18-,19+/m0/s1 |
| InChIKey | BGGDBGUQYPGRLQ-FASAQXTFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Novosphingobium rhizosphaerae (ncbitaxon:1551649) | - | PubMed (40990490) | Strain: LY |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-lariciresinoic acid (CHEBI:747598) is a aromatic ether (CHEBI:35618) |
| (+)-lariciresinoic acid (CHEBI:747598) is a carboxylic acid (CHEBI:33575) |
| (+)-lariciresinoic acid (CHEBI:747598) is a lignan (CHEBI:25036) |
| (+)-lariciresinoic acid (CHEBI:747598) is a oxolanes (CHEBI:26912) |
| (+)-lariciresinoic acid (CHEBI:747598) is a phenols (CHEBI:33853) |
| Incoming Relation(s) |
| (+)-lariciresinoate (CHEBI:747599) is conjugate base of (+)-lariciresinoic acid (CHEBI:747598) |
| Citations |
|---|