EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H31O4 |
| Net Charge | -1 |
| Average Mass | 359.486 |
| Monoisotopic Mass | 359.22278 |
| SMILES | CC/C=C\C[C@@H](O)/C=C/C=C\C/C=C\C/C=C\C=C\[C@@H](O)CCC(=O)[O-] |
| InChI | InChI=1S/C22H32O4/c1-2-3-12-15-20(23)16-13-10-8-6-4-5-7-9-11-14-17-21(24)18-19-22(25)26/h3-5,8-14,16-17,20-21,23-24H,2,6-7,15,18-19H2,1H3,(H,25,26)/p-1/b5-4-,10-8-,11-9-,12-3-,16-13+,17-14+/t20-,21-/m1/s1 |
| InChIKey | JKPUWSZSJINVLB-VDOHSOROSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspirin-triggered resolvin D6(1−) (CHEBI:747596) is a dihydroxydocosahexaenoate (CHEBI:136528) |
| aspirin-triggered resolvin D6(1−) (CHEBI:747596) is conjugate base of aspirin-triggered resolvin D6 (CHEBI:138618) |
| Incoming Relation(s) |
| aspirin-triggered resolvin D6 (CHEBI:138618) is conjugate acid of aspirin-triggered resolvin D6(1−) (CHEBI:747596) |
| IUPAC Name |
|---|
| (4S,5E,7Z,10Z,13Z,15E,17R,19Z)-4,17-dihydroxydocosa-5,7,10,13,15,19-hexaenoate |
| Synonyms | Source |
|---|---|
| 17-epi-resolvin D6(1−) | ChEBI |
| 17-epi-RvD6(1−) | ChEBI |
| (4S,5E,7Z,10Z,13Z,15E,17R,19Z)-4,17-dihydroxydocosahexaenoate | ChEBI |
| (4S,5E,7Z,10Z,13Z,15E,17R,19Z)-4,17-dihydroxydocosahexaenoic acid anion | ChEBI |
| aspirin-triggered resolvin D6 anion | ChEBI |
| aspirin-triggered RvD6(1−) | ChEBI |