EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11N3 |
| Net Charge | 0 |
| Average Mass | 125.175 |
| Monoisotopic Mass | 125.09530 |
| SMILES | CC(N)Cc1cncn1 |
| InChI | InChI=1S/C6H11N3/c1-5(7)2-6-3-8-4-9-6/h3-5H,2,7H2,1H3,(H,8,9) |
| InChIKey | XNQIOISZPFVUFG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | H3-receptor agonist A histamine agonist that binds to and activates histamine H3-receptors. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| Application: | H3-receptor agonist A histamine agonist that binds to and activates histamine H3-receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-methylhistamine (CHEBI:74759) has functional parent histamine (CHEBI:18295) |
| α-methylhistamine (CHEBI:74759) has role animal metabolite (CHEBI:75767) |
| α-methylhistamine (CHEBI:74759) has role H3-receptor agonist (CHEBI:64154) |
| α-methylhistamine (CHEBI:74759) is a aralkylamino compound (CHEBI:64365) |
| α-methylhistamine (CHEBI:74759) is a imidazoles (CHEBI:24780) |
| IUPAC Name |
|---|
| 1-(1H-imidazol-5-yl)propan-2-amine |
| Manual Xrefs | Databases |
|---|---|
| Alpha-Methylhistamine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:956816 | Reaxys |
| CAS:6986-90-9 | ChemIDplus |
| Citations |
|---|