EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H35NO10.HCl |
| Net Charge | 0 |
| Average Mass | 606.068 |
| Monoisotopic Mass | 605.20277 |
| SMILES | CC[C@@]1(O)C[C@H](O[C@H]2C[C@H](N(C)C)[C@H](O)[C@H](C)O2)c2c(cc3c(c2O)C(=O)c2c(O)cccc2C3=O)[C@H]1C(=O)OC.Cl |
| InChI | InChI=1S/C30H35NO10.ClH/c1-6-30(38)12-19(41-20-11-17(31(3)4)25(33)13(2)40-20)22-15(24(30)29(37)39-5)10-16-23(28(22)36)27(35)21-14(26(16)34)8-7-9-18(21)32;/h7-10,13,17,19-20,24-25,32-33,36,38H,6,11-12H2,1-5H3;1H/t13-,17-,19-,20-,24-,25+,30+;/m0./s1 |
| InChIKey | KTSRCTOUNGGQEI-RHYYRQJGSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aclacinomycin T hydrochloride (CHEBI:74758) has part aclacinomycin T(1+) (CHEBI:74755) |
| aclacinomycin T hydrochloride (CHEBI:74758) has role antimicrobial agent (CHEBI:33281) |
| aclacinomycin T hydrochloride (CHEBI:74758) has role antineoplastic agent (CHEBI:35610) |
| aclacinomycin T hydrochloride (CHEBI:74758) is a hydrochloride (CHEBI:36807) |
| Synonyms | Source |
|---|---|
| 1-deoxypyrromycin HCl | ChEBI |
| 1-deoxypyrromycin hydrochloride | ChEBI |
| aclacinomycin T HCl | ChEBI |
| aklavine HCl | ChEBI |
| aklavine hydrochloride | ChEBI |
| aklavin HCl | ChEBI |