EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17N3O4 |
| Net Charge | 0 |
| Average Mass | 243.263 |
| Monoisotopic Mass | 243.12191 |
| SMILES | NC(=O)CC[C@H](NC(=O)[C@@H]1CCCN1)C(=O)O |
| InChI | InChI=1S/C10H17N3O4/c11-8(14)4-3-7(10(16)17)13-9(15)6-2-1-5-12-6/h6-7,12H,1-5H2,(H2,11,14)(H,13,15)(H,16,17)/t6-,7-/m0/s1 |
| InChIKey | SHAQGFGGJSLLHE-BQBZGAKWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pro-Gln (CHEBI:74757) has role metabolite (CHEBI:25212) |
| Pro-Gln (CHEBI:74757) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-prolyl-L-glutamine |
| Synonyms | Source |
|---|---|
| PQ | ChEBI |
| prolylglutamine | ChEBI |
| L-Pro-L-Gln | ChEBI |
| Prolyl-Glutamine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029015 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:18668-08-1 | Reaxys |