EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N2O5 |
| Net Charge | 0 |
| Average Mass | 230.220 |
| Monoisotopic Mass | 230.09027 |
| SMILES | O=C(O)C[C@H](NC(=O)[C@@H]1CCCN1)C(=O)O |
| InChI | InChI=1S/C9H14N2O5/c12-7(13)4-6(9(15)16)11-8(14)5-2-1-3-10-5/h5-6,10H,1-4H2,(H,11,14)(H,12,13)(H,15,16)/t5-,6-/m0/s1 |
| InChIKey | GLEOIKLQBZNKJZ-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pro-Asp (CHEBI:74756) has role metabolite (CHEBI:25212) |
| Pro-Asp (CHEBI:74756) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-prolyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| PD | ChEBI |
| L-Pro-L-Asp | ChEBI |
| prolylaspartic acid | ChEBI |
| Prolyl-Aspartate | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029013 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22125 | Reaxys |