EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O6 |
| Net Charge | 0 |
| Average Mass | 376.449 |
| Monoisotopic Mass | 376.18859 |
| SMILES | COc1cc(CCC(O)CC(O)CCc2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C21H28O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h5-6,9-12,16-17,22-25H,3-4,7-8,13H2,1-2H3 |
| InChIKey | OELMAFBLFOKZJD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| octahydrocurcumin (CHEBI:747541) is a diarylheptanoid (CHEBI:78802) |
| octahydrocurcumin (CHEBI:747541) is a polyphenol (CHEBI:26195) |
| octahydrocurcumin (CHEBI:747541) is a β-diketone (CHEBI:67265) |
| UniProt Name | Source |
|---|---|
| octahydrocurcumin | UniProt |