EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N3O4 |
| Net Charge | 0 |
| Average Mass | 229.236 |
| Monoisotopic Mass | 229.10626 |
| SMILES | NC(=O)C[C@H](NC(=O)[C@@H]1CCCN1)C(=O)O |
| InChI | InChI=1S/C9H15N3O4/c10-7(13)4-6(9(15)16)12-8(14)5-2-1-3-11-5/h5-6,11H,1-4H2,(H2,10,13)(H,12,14)(H,15,16)/t5-,6-/m0/s1 |
| InChIKey | JQOHKCDMINQZRV-WDSKDSINSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pro-Asn (CHEBI:74754) has role metabolite (CHEBI:25212) |
| Pro-Asn (CHEBI:74754) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-prolyl-L-asparagine |
| Synonyms | Source |
|---|---|
| prolylasparagine | ChEBI |
| L-Pro-L-Asn | ChEBI |
| PN | ChEBI |
| Prolyl-Asparagine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029012 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13311498 | Reaxys |