EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21N3O3 |
| Net Charge | 0 |
| Average Mass | 351.406 |
| Monoisotopic Mass | 351.15829 |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C20H21N3O3/c21-16(10-13-6-2-1-3-7-13)19(24)23-18(20(25)26)11-14-12-22-17-9-5-4-8-15(14)17/h1-9,12,16,18,22H,10-11,21H2,(H,23,24)(H,25,26)/t16-,18-/m0/s1 |
| InChIKey | JMCOUWKXLXDERB-WMZOPIPTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phe-Trp (CHEBI:74751) has role metabolite (CHEBI:25212) |
| Phe-Trp (CHEBI:74751) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-phenylalanyl-L-tryptophan |
| Synonyms | Source |
|---|---|
| FW | ChEBI |
| N-(3-phenyl-L-alanyl)-L-tryptophan | ChemIDplus |
| N-L-phenylalanyl-L-tryptophan | ChemIDplus |
| phenylalanyltryptophan | ChemIDplus |
| Phenylalanyl-Tryptophan | HMDB |
| L-Phe-L-Trp | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029006 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5145119 | Reaxys |
| CAS:24587-41-5 | ChemIDplus |