EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N2O3 |
| Net Charge | 0 |
| Average Mass | 262.309 |
| Monoisotopic Mass | 262.13174 |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C14H18N2O3/c15-11(9-10-5-2-1-3-6-10)13(17)16-8-4-7-12(16)14(18)19/h1-3,5-6,11-12H,4,7-9,15H2,(H,18,19)/t11-,12-/m0/s1 |
| InChIKey | WEQJQNWXCSUVMA-RYUDHWBXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phe-Pro (CHEBI:74750) has role metabolite (CHEBI:25212) |
| Phe-Pro (CHEBI:74750) is a dipeptide (CHEBI:46761) |
| Incoming Relation(s) |
| L-phenylalanyl-L-proline zwitterion (CHEBI:760683) is tautomer of Phe-Pro (CHEBI:74750) |
| IUPAC Name |
|---|
| L-phenylalanyl-L-proline |
| Synonyms | Source |
|---|---|
| FP | ChEBI |
| phenylalanylproline | ChEBI |
| L-Phe-L-Pro | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011177 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4322003 | Reaxys |