EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C48H48F2N10O5 |
| Net Charge | 0 |
| Average Mass | 882.973 |
| Monoisotopic Mass | 882.37772 |
| SMILES | Cc1cc(-n2nc3c(c2-n2ccn(-c4ccc5c(cnn5C)c4F)c2=O)[C@H](C)N(C(=O)c2cc4cc([C@H]5CCOC(C)(C)C5)ccc4n2[C@@]2(c4noc(=O)n4)C[C@@H]2C)CC3)cc(C)c1F |
| InChI | InChI=1S/C48H48F2N10O5/c1-25-18-32(19-26(2)40(25)49)60-42(58-16-15-57(46(58)63)37-11-10-36-33(41(37)50)24-51-55(36)7)39-28(4)56(14-12-34(39)53-60)43(61)38-21-31-20-29(30-13-17-64-47(5,6)23-30)8-9-35(31)59(38)48(22-27(48)3)44-52-45(62)65-54-44/h8-11,15-16,18-21,24,27-28,30H,12-14,17,22-23H2,1-7H3,(H,52,54,62)/t27-,28-,30-,48-/m0/s1 |
| InChIKey | USUWIEBBBWHKNI-KHIFEHGGSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| orforglipron (CHEBI:747472) has role anti-obesity agent (CHEBI:74518) |
| orforglipron (CHEBI:747472) has role hypoglycemic agent (CHEBI:35526) |
| orforglipron (CHEBI:747472) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| orforglipron | WHO MedNet |
| Synonyms | Source |
|---|---|
| LY-3502970 | ChEMBL |
| LY3502970 | ChEMBL |
| Citations |
|---|