EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25N3O2 |
| Net Charge | 0 |
| Average Mass | 363.461 |
| Monoisotopic Mass | 363.19468 |
| SMILES | CCC(=O)N[C@@H]1CCCc2c(-c3ccc4c(c3)CCC(=O)N4C)cncc21 |
| InChI | InChI=1S/C22H25N3O2/c1-3-21(26)24-19-6-4-5-16-17(12-23-13-18(16)19)14-7-9-20-15(11-14)8-10-22(27)25(20)2/h7,9,11-13,19H,3-6,8,10H2,1-2H3,(H,24,26)/t19-/m1/s1 |
| InChIKey | VDEUDSRUMNAXJG-LJQANCHMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| baxdrostat (CHEBI:747471) has role antiatherosclerotic agent (CHEBI:145947) |
| baxdrostat (CHEBI:747471) has role antihypertensive agent (CHEBI:35674) |
| baxdrostat (CHEBI:747471) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| Baxdrostat | ChEMBL |
| CIN-107 | ChEMBL |
| Ro6836191 | ChEMBL |
| RO-6836191 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| Baxdrostat | Wikipedia |
| D12789 | KEGG DRUG |
| DB19090 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:1428652-17-8 | DrugBank |