EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30N6O2 |
| Net Charge | 0 |
| Average Mass | 446.555 |
| Monoisotopic Mass | 446.24302 |
| SMILES | CC(=O)c1c(C)c2cnc(Nc3ccc(C4CCNCC4)cn3)nc2n(C2CCCC2)c1=O |
| InChI | InChI=1S/C25H30N6O2/c1-15-20-14-28-25(29-21-8-7-18(13-27-21)17-9-11-26-12-10-17)30-23(20)31(19-5-3-4-6-19)24(33)22(15)16(2)32/h7-8,13-14,17,19,26H,3-6,9-12H2,1-2H3,(H,27,28,29,30) |
| InChIKey | SGJLSPUSUBJWHO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dalpiciclib (CHEBI:747469) has role antineoplastic agent (CHEBI:35610) |
| dalpiciclib (CHEBI:747469) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| dalpiciclib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Cdk4/6 inhibitor shr6390 | DrugBank |
| Shr-6390 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| DB17456 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:1637781-04-4 | DrugBank |
| Citations |
|---|