EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9O2 |
| Net Charge | -1 |
| Average Mass | 149.169 |
| Monoisotopic Mass | 149.06080 |
| SMILES | C[C@H](C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C9H10O2/c1-7(9(10)11)8-5-3-2-4-6-8/h2-7H,1H3,(H,10,11)/p-1/t7-/m0/s1 |
| InChIKey | YPGCWEMNNLXISK-ZETCQYMHSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-phenylpropionate (CHEBI:747462) is a 2-Phenylpropionate (CHEBI:177275) |
| (2S)-2-phenylpropionate (CHEBI:747462) is a monocarboxylic acid anion (CHEBI:35757) |
| UniProt Name | Source |
|---|---|
| (2S)-2-phenylpropanoate | UniProt |
| Citations |
|---|