EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27ClFN5O3 |
| Net Charge | 0 |
| Average Mass | 463.941 |
| Monoisotopic Mass | 463.17865 |
| SMILES | CC(C)n1c(C(C)(C)O)nc2c(F)cc(-c3nc(N[C@@H]4CCOC[C@H]4O)ncc3Cl)cc21 |
| InChI | InChI=1S/C22H27ClFN5O3/c1-11(2)29-16-8-12(7-14(24)19(16)27-20(29)22(3,4)31)18-13(23)9-25-21(28-18)26-15-5-6-32-10-17(15)30/h7-9,11,15,17,30-31H,5-6,10H2,1-4H3,(H,25,26,28)/t15-,17-/m1/s1 |
| InChIKey | QYJLBHRAPDJOSO-NVXWUHKLSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atirmociclib (CHEBI:747454) has role antineoplastic agent (CHEBI:35610) |
| atirmociclib (CHEBI:747454) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| atirmociclib | WHO MedNet |
| Synonyms | Source |
|---|---|
| PF-07220060 | ChEMBL |
| PF07220060 | ChEMBL |
| Citations |
|---|