EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6N2O2 |
| Net Charge | 0 |
| Average Mass | 126.115 |
| Monoisotopic Mass | 126.04293 |
| SMILES | Cc1nncc1C(=O)O |
| InChI | InChI=1S/C5H6N2O2/c1-3-4(5(8)9)2-6-7-3/h2H,1H3,(H,6,7)(H,8,9) |
| InChIKey | HLYYXPDTFLUERX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methyl-pyrazole-4-carboxylic acid (CHEBI:74742) has parent hydride 1H-pyrazole (CHEBI:17241) |
| 3-methyl-pyrazole-4-carboxylic acid (CHEBI:74742) has role metabolite (CHEBI:25212) |
| 3-methyl-pyrazole-4-carboxylic acid (CHEBI:74742) is a monocarboxylic acid (CHEBI:25384) |
| 3-methyl-pyrazole-4-carboxylic acid (CHEBI:74742) is a pyrazoles (CHEBI:26410) |
| IUPAC Name |
|---|
| 3-methyl-1H-pyrazole-4-carboxylic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2909 | Reaxys |