EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12FN5O3 |
| Net Charge | 0 |
| Average Mass | 293.258 |
| Monoisotopic Mass | 293.09242 |
| SMILES | C#C[C@]1(CO)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1O |
| InChI | InChI=1S/C12H12FN5O3/c1-2-12(4-19)6(20)3-7(21-12)18-5-15-8-9(14)16-11(13)17-10(8)18/h1,5-7,19-20H,3-4H2,(H2,14,16,17)/t6-,7+,12+/m0/s1 |
| InChIKey | IKKXOSBHLYMWAE-QRPMWFLTSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| islatravir (CHEBI:747369) has role anti-HIV agent (CHEBI:64946) |
| islatravir (CHEBI:747369) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| islatravir | WHO MedNet |
| Synonyms | Source |
|---|---|
| Islatravir anhydrous | ChEMBL |
| MK-8591 | ChEMBL |
| Citations |
|---|