EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6N2O2 |
| Net Charge | 0 |
| Average Mass | 126.115 |
| Monoisotopic Mass | 126.04293 |
| SMILES | Cc1cc(=O)nc(=O)n1 |
| InChI | InChI=1S/C5H6N2O2/c1-3-2-4(8)7-5(9)6-3/h2H,1H3,(H2,6,7,8,9) |
| InChIKey | SHVCSCWHWMSGTE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-methyluracil (CHEBI:74733) has functional parent uracil (CHEBI:17568) |
| 6-methyluracil (CHEBI:74733) has role metabolite (CHEBI:25212) |
| 6-methyluracil (CHEBI:74733) is a pyrimidone (CHEBI:38337) |
| IUPAC Name |
|---|
| 6-methylpyrimidine-2,4(1H,3H)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:115647 | Reaxys |
| CAS:626-48-2 | ChemIDplus |
| Citations |
|---|