EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6N2O2 |
| Net Charge | 0 |
| Average Mass | 126.115 |
| Monoisotopic Mass | 126.04293 |
| SMILES | Cn1c(=O)ccnc1=O |
| InChI | InChI=1S/C5H6N2O2/c1-7-4(8)2-3-6-5(7)9/h2-3H,1H3,(H,6,9) |
| InChIKey | VPLZGVOSFFCKFC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methyluracil (CHEBI:74732) has functional parent uracil (CHEBI:17568) |
| 3-methyluracil (CHEBI:74732) has role metabolite (CHEBI:25212) |
| 3-methyluracil (CHEBI:74732) is a nucleobase analogue (CHEBI:67142) |
| 3-methyluracil (CHEBI:74732) is a pyrimidone (CHEBI:38337) |
| IUPAC Name |
|---|
| 3-methylpyrimidine-2,4(1H,3H)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:117810 | Reaxys |
| CAS:608-34-4 | ChemIDplus |
| Citations |
|---|