EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19N3O2 |
| Net Charge | 0 |
| Average Mass | 273.336 |
| Monoisotopic Mass | 273.14773 |
| SMILES | CCOC(=O)/C(C#N)=C(\N)c1ccc(N(C)CC)cc1 |
| InChI | InChI=1S/C15H19N3O2/c1-4-18(3)12-8-6-11(7-9-12)14(17)13(10-16)15(19)20-5-2/h6-9H,4-5,17H2,1-3H3/b14-13- |
| InChIKey | LNAZEQHZUUSJMX-YPKPFQOOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | fungicide A substance used to destroy fungal pests. |
| Application: | fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amfenamacril (CHEBI:747317) has role fungicide (CHEBI:24127) |
| amfenamacril (CHEBI:747317) is a cinnamate ester (CHEBI:36087) |
| amfenamacril (CHEBI:747317) is a enamine (CHEBI:47989) |
| amfenamacril (CHEBI:747317) is a ethyl ester (CHEBI:23990) |
| amfenamacril (CHEBI:747317) is a nitrile (CHEBI:18379) |
| amfenamacril (CHEBI:747317) is a primary amino compound (CHEBI:50994) |
| amfenamacril (CHEBI:747317) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| ethyl (2Z)-3-amino-2-cyano-3-{4-[ethyl(methyl)amino]phenyl}prop-2-enoate |
| Synonyms | Source |
|---|---|
| ethyl (2Z)-3-amino-2-cyano-3-[4-(ethylmethylamino)phenyl]-2-propenoate | Alan Wood's Pesticides |
| ethyl (Z)-3-amino-2-cyano-3-{4-[ethyl(methyl)amino]phenyl}acrylate | ChEBI |
| ethyl (Z)-3-amino-2-cyano-3-{4-[ethyl(methyl)amino]phenyl}prop-2-enoate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:41827902 | Reaxys |
| CAS:3095661-21-2 | Alan Wood's Pesticides |