EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24N2O12 |
| Net Charge | 0 |
| Average Mass | 436.370 |
| Monoisotopic Mass | 436.13292 |
| SMILES | O=C(O)C[C@@](O)(CC(=O)NCCCCNC(=O)C[C@](O)(CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C16H24N2O12/c19-9(5-15(29,13(25)26)7-11(21)22)17-3-1-2-4-18-10(20)6-16(30,14(27)28)8-12(23)24/h29-30H,1-8H2,(H,17,19)(H,18,20)(H,21,22)(H,23,24)(H,25,26)(H,27,28)/t15-,16-/m0/s1 |
| InChIKey | KUYCNLUJQMRORQ-HOTGVXAUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ralstonia pickettii (ncbitaxon:329) | - | DOI (10.1016/j.phytol.2019.07.012) | Strain: DSM 6297 |
| Roles Classification |
|---|
| Chemical Roles: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S,S)-rhizoferrin (CHEBI:747301) has role bacterial metabolite (CHEBI:76969) |
| (S,S)-rhizoferrin (CHEBI:747301) has role siderophore (CHEBI:26672) |
| (S,S)-rhizoferrin (CHEBI:747301) is a diol (CHEBI:23824) |
| (S,S)-rhizoferrin (CHEBI:747301) is a secondary carboxamide (CHEBI:140325) |
| (S,S)-rhizoferrin (CHEBI:747301) is a tertiary alcohol (CHEBI:26878) |
| (S,S)-rhizoferrin (CHEBI:747301) is a tetracarboxylic acid (CHEBI:35742) |
| IUPAC Name |
|---|
| (2S,2'S)-2,2'-{butane-1,4-diylbis[imino(2-oxoethane-2,1-diyl)]}bis(2-hydroxybutanedioic acid) |
| Synonyms | Source |
|---|---|
| enantio-rhizoferrin | ChEBI |
| S,S-rhizoferrin | ChEBI |
| Citations |
|---|