EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Mg.H2O4P.H2O4P |
| Net Charge | 0 |
| Average Mass | 218.277 |
| Monoisotopic Mass | 217.92318 |
| SMILES | O=P([O-])(O)O.O=P([O-])(O)O.[Mg+2] |
| InChI | InChI=1S/Mg.2H3O4P/c;2*1-5(2,3)4/h;2*(H3,1,2,3,4)/q+2;;/p-2 |
| InChIKey | QQFLQYOOQVLGTQ-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| Biological Roles: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. nutrient A nutrient is a food component that an organism uses to survive and grow. |
| Application: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monomagnesium phosphate (CHEBI:747293) has role food acidity regulator (CHEBI:64049) |
| monomagnesium phosphate (CHEBI:747293) is a magnesium phosphate (CHEBI:747291) |
| IUPAC Name |
|---|
| magnesium bis(dihydrogen phosphate) |
| Synonyms | Source |
|---|---|
| acid magnesium phosphate | ChEBI |
| magnesium biphosphate | CAS |
| magnesium bis(orthophosphate) | CAS |
| magnesium dibasic phosphate | CAS |
| magnesium dihydrogen orthophosphate | CAS |
| magnesium dihydrogen phosphate | CAS |
| Manual Xrefs | Databases |
|---|---|
| Monomagnesium_phosphate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:13092-66-5 | ChEBI |