EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:74723 - 3,6-diaminoacridine dihydrochloride
| Formula | C13H11N3.2HCl |
| Net Charge | 0 |
| Average Mass | 282.174 |
| Monoisotopic Mass | 281.04865 |
| SMILES | Cl.Cl.Nc1ccc2cc3ccc(N)cc3nc2c1 |
| InChI | InChI=1S/C13H11N3.2ClH/c14-10-3-1-8-5-9-2-4-11(15)7-13(9)16-12(8)6-10;;/h1-7H,14-15H2;2*1H |
| InChIKey | YHIHFKAEJAVELI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. intercalator A role played by a chemical agent which exhibits the capability of occupying space between DNA base pairs due to particular properties in size, shape and charge. Intercalation of chemical compounds in DNA helix can result in replication errors (shift, mutation) or DNA damages. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,6-diaminoacridine dihydrochloride (CHEBI:74723) has part 3,6-diaminoacridine(2+) (CHEBI:74713) |
| 3,6-diaminoacridine dihydrochloride (CHEBI:74723) has role antibacterial agent (CHEBI:33282) |
| 3,6-diaminoacridine dihydrochloride (CHEBI:74723) has role antiseptic drug (CHEBI:48218) |
| 3,6-diaminoacridine dihydrochloride (CHEBI:74723) has role carcinogenic agent (CHEBI:50903) |
| 3,6-diaminoacridine dihydrochloride (CHEBI:74723) has role intercalator (CHEBI:24853) |
| 3,6-diaminoacridine dihydrochloride (CHEBI:74723) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| acriflavinium chloride (CHEBI:74728) has part 3,6-diaminoacridine dihydrochloride (CHEBI:74723) |
| IUPAC Name |
|---|
| acridine-3,6-diamine dihydrochloride |
| Synonyms | Source |
|---|---|
| 3,6-diaminoacridinium chloride hydrochloride | ChemIDplus |
| 3-amino-6-ammonioacridinium dichloride | IUPAC |
| proflavin.2HCl | ChEBI |
| proflavine dihydrochloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:531-73-7 | ChemIDplus |
| Citations |
|---|