EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H16ClF6N5O |
| Net Charge | 0 |
| Average Mass | 587.911 |
| Monoisotopic Mass | 587.09476 |
| SMILES | O=C(c1ccccc1Cl)c1cccnc1-c1nnn(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1-c1ccncc1 |
| InChI | InChI=1S/C28H16ClF6N5O/c29-22-6-2-1-4-20(22)26(41)21-5-3-9-37-23(21)24-25(17-7-10-36-11-8-17)40(39-38-24)15-16-12-18(27(30,31)32)14-19(13-16)28(33,34)35/h1-14H,15H2 |
| InChIKey | CAVRKWRKTNINFF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tradipitant (CHEBI:747212) has role antiviral agent (CHEBI:22587) |
| tradipitant (CHEBI:747212) has role dermatologic drug (CHEBI:50177) |
| tradipitant (CHEBI:747212) has role gastrointestinal drug (CHEBI:55324) |
| tradipitant (CHEBI:747212) is a organic molecular entity (CHEBI:50860) |
| INN | Source |
|---|---|
| tradipitant | WHO MedNet |
| Synonyms | Source |
|---|---|
| LY-686017 | ChEMBL |
| LY686017 | ChEMBL |
| VLY-686 | ChEMBL |