EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H12BrF12N3O2 |
| Net Charge | 0 |
| Average Mass | 706.281 |
| Monoisotopic Mass | 704.99213 |
| SMILES | N#CCN(C(=O)c1ccc(F)cc1)c1cccc(C(=O)Nc2c(Br)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2C(F)(F)F)c1F |
| InChI | InChI=1S/C26H12BrF12N3O2/c27-17-11-13(23(30,25(34,35)36)26(37,38)39)10-16(24(31,32)33)20(17)41-21(43)15-2-1-3-18(19(15)29)42(9-8-40)22(44)12-4-6-14(28)7-5-12/h1-7,10-11H,9H2,(H,41,43) |
| InChIKey | YYTNNGQZJDLGSV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyanoflanilide (CHEBI:747196) has role agrochemical (CHEBI:33286) |
| cyanoflanilide (CHEBI:747196) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| cyanoflanilide (CHEBI:747196) is a benzamides (CHEBI:22702) |
| cyanoflanilide (CHEBI:747196) is a bromobenzenes (CHEBI:37149) |
| cyanoflanilide (CHEBI:747196) is a monofluorobenzenes (CHEBI:83575) |
| cyanoflanilide (CHEBI:747196) is a nitrile (CHEBI:18379) |
| cyanoflanilide (CHEBI:747196) is a organofluorine insecticide (CHEBI:38804) |
| cyanoflanilide (CHEBI:747196) is a secondary carboxamide (CHEBI:140325) |
| cyanoflanilide (CHEBI:747196) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]-3-[(cyanomethyl)(4-fluorobenzoyl)amino]-2-fluorobenzamide |
| Synonyms | Source |
|---|---|
| 2′-bromo-3-[N-(cyanomethyl)-4-fluorobenzamido]-2-fluoro-4′-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]-6′-(trifluoromethyl)benzanilide | Alan Wood's Pesticides |
| N-[2-bromo-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-6-(trifluoromethyl)phenyl]-3-[N-(cyanomethyl)-4-fluorobenzamido]-2-fluorobenzamide | Alan Wood's Pesticides |
| N-[2-bromo-4-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]-6-(trifluoromethyl)phenyl]-3-[N-(cyanomethyl)-4-fluorobenzamido]-2-fluorobenzamide | Alan Wood's Pesticides |
| N-[3-[[[2-bromo-4-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethyl]-6-(trifluoromethyl)phenyl]amino]carbonyl]-2-fluorophenyl]-N-(cyanomethyl)-4-fluorobenzamide | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| cyanoflanilide | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:50022174 | Reaxys |
| CAS:2915290-26-3 | Alan Wood's Pesticides |