EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11N3.HCl |
| Net Charge | 0 |
| Average Mass | 245.713 |
| Monoisotopic Mass | 245.07198 |
| SMILES | Cl.Nc1ccc2cc3ccc(N)cc3nc2c1 |
| InChI | InChI=1S/C13H11N3.ClH/c14-10-3-1-8-5-9-2-4-11(15)7-13(9)16-12(8)6-10;/h1-7H,14-15H2;1H |
| InChIKey | PBBGTVBGXBUVLT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. intercalator A role played by a chemical agent which exhibits the capability of occupying space between DNA base pairs due to particular properties in size, shape and charge. Intercalation of chemical compounds in DNA helix can result in replication errors (shift, mutation) or DNA damages. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,6-diaminoacridine monohydrochloride (CHEBI:74718) has part 3,6-diaminoacridine(1+) (CHEBI:74711) |
| 3,6-diaminoacridine monohydrochloride (CHEBI:74718) has role antibacterial agent (CHEBI:33282) |
| 3,6-diaminoacridine monohydrochloride (CHEBI:74718) has role antiseptic drug (CHEBI:48218) |
| 3,6-diaminoacridine monohydrochloride (CHEBI:74718) has role carcinogenic agent (CHEBI:50903) |
| 3,6-diaminoacridine monohydrochloride (CHEBI:74718) has role intercalator (CHEBI:24853) |
| 3,6-diaminoacridine monohydrochloride (CHEBI:74718) is a hydrochloride (CHEBI:36807) |
| Incoming Relation(s) |
| acriflavinium monochloride (CHEBI:74729) has part 3,6-diaminoacridine monohydrochloride (CHEBI:74718) |
| IUPAC Name |
|---|
| acridine-3,6-diamine hydrochloride |
| Synonyms | Source |
|---|---|
| 3,6-diaminoacridine HCl | ChEBI |
| 3,6-diaminoacridine.HCl | ChEBI |
| 3,6-diaminoacridinium chloride | IUPAC |
| proflavine HCl | ChemIDplus |
| proflavine.HCl | ChEBI |
| proflavine hydrochloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4023620 | Reaxys |
| CAS:952-23-8 | ChemIDplus |
| Citations |
|---|